C34H6F14 — CID 102086543
1,2,3,4,5,6,8-heptafluoro-7-[2-[6-[2-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)ethynyl]naphthalen-2-yl]ethynyl]naphthalene (PubChem CID 102086543) has the molecular formula C34H6F14 and a molecular weight of 680.39 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptafluoro-7-[2-[6-[2-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)ethynyl]naphthalen-2-yl]ethynyl]naphthalene.
| Compound Name | 1,2,3,4,5,6,8-heptafluoro-7-[2-[6-[2-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)ethynyl]naphthalen-2-yl]ethynyl]naphthalene |
|---|---|
| PubChem CID | 102086543 |
| Molecular Formula | C34H6F14 |
| Molecular Weight | 680.39 g/mol |
| Exact Mass | 680.02 |
| IUPAC Name | 1,2,3,4,5,6,8-heptafluoro-7-[2-[6-[2-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)ethynyl]naphthalen-2-yl]ethynyl]naphthalene |
| SMILES | Fc1c(F)c(F)c2c(F)c(C#Cc3ccc4cc(C#Cc5c(F)c(F)c6c(F)c(F)c(F)c(F)c6c5F)ccc4c3)c(F)c(F)c2c1F |
| InChI | InChI=1S/C34H6F14/c35-21-15(23(37)25(39)19-17(21)27(41)31(45)33(47)29(19)43)7-3-11-1-5-13-10-12(2-6-14(13)9-11)4-8-16-22(36)18-20(26(40)24(16)38)30(44)34(48)32(46)28(18)42/h1-2,5-6,9-10H |
| InChIKey | GQDJMYPEFDGQEG-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.39 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|