C26H18F4 — CID 21359675
1,2,4,5-tetrafluoro-3-[2-(4-methylphenyl)ethynyl]-6-[2-(2,4,6-trimethylphenyl)ethynyl]benzene (PubChem CID 21359675) has the molecular formula C26H18F4 and a molecular weight of 406.42 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-[2-(4-methylphenyl)ethynyl]-6-[2-(2,4,6-trimethylphenyl)ethynyl]benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-[2-(4-methylphenyl)ethynyl]-6-[2-(2,4,6-trimethylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 21359675 |
| Molecular Formula | C26H18F4 |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-[2-(4-methylphenyl)ethynyl]-6-[2-(2,4,6-trimethylphenyl)ethynyl]benzene |
| SMILES | Cc1ccc(C#Cc2c(F)c(F)c(C#Cc3c(C)cc(C)cc3C)c(F)c2F)cc1 |
| InChI | InChI=1S/C26H18F4/c1-15-5-7-19(8-6-15)9-10-21-23(27)25(29)22(26(30)24(21)28)12-11-20-17(3)13-16(2)14-18(20)4/h5-8,13-14H,1-4H3 |
| InChIKey | YHBWGDYUQOXQSM-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|