C26H22S — CID 175617249
5-[2-(4-methylphenyl)ethynyl]-2-[2-(2,4,6-trimethylphenyl)ethynyl]benzenethiol (PubChem CID 175617249) has the molecular formula C26H22S and a molecular weight of 366.53 g/mol. Its IUPAC name is 5-[2-(4-methylphenyl)ethynyl]-2-[2-(2,4,6-trimethylphenyl)ethynyl]benzenethiol.
| Compound Name | 5-[2-(4-methylphenyl)ethynyl]-2-[2-(2,4,6-trimethylphenyl)ethynyl]benzenethiol |
|---|---|
| PubChem CID | 175617249 |
| Molecular Formula | C26H22S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 5-[2-(4-methylphenyl)ethynyl]-2-[2-(2,4,6-trimethylphenyl)ethynyl]benzenethiol |
| SMILES | Cc1ccc(C#Cc2ccc(C#Cc3c(C)cc(C)cc3C)c(S)c2)cc1 |
| InChI | InChI=1S/C26H22S/c1-18-5-7-22(8-6-18)9-10-23-11-12-24(26(27)17-23)13-14-25-20(3)15-19(2)16-21(25)4/h5-8,11-12,15-17,27H,1-4H3 |
| InChIKey | HHCLQTSEJFQBPJ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|