C22H8F5N2+ — CID 101335846
4-[2-[4-[2-(2,3,4,5,6-pentafluorophenyl)ethynyl]phenyl]ethynyl]benzenediazonium (PubChem CID 101335846) has the molecular formula C22H8F5N2+ and a molecular weight of 395.31 g/mol. Its IUPAC name is 4-[2-[4-[2-(2,3,4,5,6-pentafluorophenyl)ethynyl]phenyl]ethynyl]benzenediazonium.
| Compound Name | 4-[2-[4-[2-(2,3,4,5,6-pentafluorophenyl)ethynyl]phenyl]ethynyl]benzenediazonium |
|---|---|
| PubChem CID | 101335846 |
| Molecular Formula | C22H8F5N2+ |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 4-[2-[4-[2-(2,3,4,5,6-pentafluorophenyl)ethynyl]phenyl]ethynyl]benzenediazonium |
| SMILES | N#[N+]c1ccc(C#Cc2ccc(C#Cc3c(F)c(F)c(F)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C22H8F5N2/c23-18-17(19(24)21(26)22(27)20(18)25)12-9-14-4-1-13(2-5-14)3-6-15-7-10-16(29-28)11-8-15/h1-2,4-5,7-8,10-11H/q+1 |
| InChIKey | GBYLIZAMEKUZHN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|