C30H12F3N3O6 — CID 71417763
1,3,5-trifluoro-2,4,6-tris[2-(4-nitrophenyl)ethynyl]benzene (PubChem CID 71417763) has the molecular formula C30H12F3N3O6 and a molecular weight of 567.44 g/mol. Its IUPAC name is 1,3,5-trifluoro-2,4,6-tris[2-(4-nitrophenyl)ethynyl]benzene.
| Compound Name | 1,3,5-trifluoro-2,4,6-tris[2-(4-nitrophenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 71417763 |
| Molecular Formula | C30H12F3N3O6 |
| Molecular Weight | 567.44 g/mol |
| Exact Mass | 567.07 |
| IUPAC Name | 1,3,5-trifluoro-2,4,6-tris[2-(4-nitrophenyl)ethynyl]benzene |
| SMILES | O=[N+]([O-])c1ccc(C#Cc2c(F)c(C#Cc3ccc([N+](=O)[O-])cc3)c(F)c(C#Cc3ccc([N+](=O)[O-])cc3)c2F)cc1 |
| InChI | InChI=1S/C30H12F3N3O6/c31-28-25(16-7-19-1-10-22(11-2-19)34(37)38)29(32)27(18-9-21-5-14-24(15-6-21)36(41)42)30(33)26(28)17-8-20-3-12-23(13-4-20)35(39)40/h1-6,10-15H |
| InChIKey | RGWZFDFRMLIFOS-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.44 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|