C23H7F5N2O2 — CID 86042730
4-[2-[3-nitro-4-[2-(2,3,4,5,6-pentafluorophenyl)ethynyl]phenyl]ethynyl]benzonitrile (PubChem CID 86042730) has the molecular formula C23H7F5N2O2 and a molecular weight of 438.31 g/mol. Its IUPAC name is 4-[2-[3-nitro-4-[2-(2,3,4,5,6-pentafluorophenyl)ethynyl]phenyl]ethynyl]benzonitrile.
| Compound Name | 4-[2-[3-nitro-4-[2-(2,3,4,5,6-pentafluorophenyl)ethynyl]phenyl]ethynyl]benzonitrile |
|---|---|
| PubChem CID | 86042730 |
| Molecular Formula | C23H7F5N2O2 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | 4-[2-[3-nitro-4-[2-(2,3,4,5,6-pentafluorophenyl)ethynyl]phenyl]ethynyl]benzonitrile |
| SMILES | N#Cc1ccc(C#Cc2ccc(C#Cc3c(F)c(F)c(F)c(F)c3F)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C23H7F5N2O2/c24-19-17(20(25)22(27)23(28)21(19)26)10-9-16-8-7-14(11-18(16)30(31)32)4-1-13-2-5-15(12-29)6-3-13/h2-3,5-8,11H |
| InChIKey | TWNPTOUMHWPFPB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|