C27H15F4NO3S — CID 142187618
S-[4-[2-[3-nitro-4-[2-(2,3,4,5-tetrafluoro-6-prop-1-en-2-ylphenyl)ethynyl]phenyl]ethynyl]phenyl] ethanethioate (PubChem CID 142187618) has the molecular formula C27H15F4NO3S and a molecular weight of 509.48 g/mol. Its IUPAC name is S-[4-[2-[3-nitro-4-[2-(2,3,4,5-tetrafluoro-6-prop-1-en-2-ylphenyl)ethynyl]phenyl]ethynyl]phenyl] ethanethioate.
| Compound Name | S-[4-[2-[3-nitro-4-[2-(2,3,4,5-tetrafluoro-6-prop-1-en-2-ylphenyl)ethynyl]phenyl]ethynyl]phenyl] ethanethioate |
|---|---|
| PubChem CID | 142187618 |
| Molecular Formula | C27H15F4NO3S |
| Molecular Weight | 509.48 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | S-[4-[2-[3-nitro-4-[2-(2,3,4,5-tetrafluoro-6-prop-1-en-2-ylphenyl)ethynyl]phenyl]ethynyl]phenyl] ethanethioate |
| SMILES | C=C(C)c1c(F)c(F)c(F)c(F)c1C#Cc1ccc(C#Cc2ccc(SC(C)=O)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H15F4NO3S/c1-15(2)23-21(24(28)26(30)27(31)25(23)29)13-10-19-9-6-18(14-22(19)32(34)35)5-4-17-7-11-20(12-8-17)36-16(3)33/h6-9,11-12,14H,1H2,2-3H3 |
| InChIKey | CDJKGKBNJRICSN-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.48 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|