C22H13N3O3S — CID 10272245
S-[4-[2-[2-nitro-4-(2-pyrimidin-5-ylethynyl)phenyl]ethynyl]phenyl] ethanethioate (PubChem CID 10272245) has the molecular formula C22H13N3O3S and a molecular weight of 399.43 g/mol. Its IUPAC name is S-[4-[2-[2-nitro-4-(2-pyrimidin-5-ylethynyl)phenyl]ethynyl]phenyl] ethanethioate.
| Compound Name | S-[4-[2-[2-nitro-4-(2-pyrimidin-5-ylethynyl)phenyl]ethynyl]phenyl] ethanethioate |
|---|---|
| PubChem CID | 10272245 |
| Molecular Formula | C22H13N3O3S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | S-[4-[2-[2-nitro-4-(2-pyrimidin-5-ylethynyl)phenyl]ethynyl]phenyl] ethanethioate |
| SMILES | CC(=O)Sc1ccc(C#Cc2ccc(C#Cc3cncnc3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H13N3O3S/c1-16(26)29-21-10-6-17(7-11-21)4-8-20-9-5-18(12-22(20)25(27)28)2-3-19-13-23-15-24-14-19/h5-7,9-15H,1H3 |
| InChIKey | ZWNNZMXINFBSIT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 85.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|