C22H16N2O2 — CID 102104003
N,N-dimethyl-4-[2-[3-[2-(4-nitrophenyl)ethynyl]cyclobuta-1,3-dien-1-yl]ethynyl]aniline (PubChem CID 102104003) has the molecular formula C22H16N2O2 and a molecular weight of 340.38 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-[3-[2-(4-nitrophenyl)ethynyl]cyclobuta-1,3-dien-1-yl]ethynyl]aniline.
| Compound Name | N,N-dimethyl-4-[2-[3-[2-(4-nitrophenyl)ethynyl]cyclobuta-1,3-dien-1-yl]ethynyl]aniline |
|---|---|
| PubChem CID | 102104003 |
| Molecular Formula | C22H16N2O2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N,N-dimethyl-4-[2-[3-[2-(4-nitrophenyl)ethynyl]cyclobuta-1,3-dien-1-yl]ethynyl]aniline |
| SMILES | CN(C)c1ccc(C#CC2=CC(C#Cc3ccc([N+](=O)[O-])cc3)=C2)cc1 |
| InChI | InChI=1S/C22H16N2O2/c1-23(2)21-11-7-17(8-12-21)3-5-19-15-20(16-19)6-4-18-9-13-22(14-10-18)24(25)26/h7-16H,1-2H3 |
| InChIKey | YDWSAZIPWMGLAB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|