C29H24N4O5S — CID 134935485
[5-[[4-(dimethylamino)phenyl]diazenyl]-2-[2-(4-nitrophenyl)ethynyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 134935485) has the molecular formula C29H24N4O5S and a molecular weight of 540.60 g/mol. Its IUPAC name is [5-[[4-(dimethylamino)phenyl]diazenyl]-2-[2-(4-nitrophenyl)ethynyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [5-[[4-(dimethylamino)phenyl]diazenyl]-2-[2-(4-nitrophenyl)ethynyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134935485 |
| Molecular Formula | C29H24N4O5S |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | [5-[[4-(dimethylamino)phenyl]diazenyl]-2-[2-(4-nitrophenyl)ethynyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cc(/N=N/c3ccc(N(C)C)cc3)ccc2C#Cc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C29H24N4O5S/c1-21-4-18-28(19-5-21)39(36,37)38-29-20-25(31-30-24-12-16-26(17-13-24)32(2)3)11-10-23(29)9-6-22-7-14-27(15-8-22)33(34)35/h4-5,7-8,10-20H,1-3H3/b31-30+ |
| InChIKey | KXFLTSCWPYNEFA-NVQSTNCTSA-N |
| XLogP | 6.55 |
| TPSA | 114.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|