C41H45N3O2Si — CID 15807635
4-[3-[2-[4-(dimethylamino)phenyl]ethynyl]-4-[2-(4-nitrophenyl)ethynyl]-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-N,N-dimethylaniline (PubChem CID 15807635) has the molecular formula C41H45N3O2Si and a molecular weight of 639.92 g/mol. Its IUPAC name is 4-[3-[2-[4-(dimethylamino)phenyl]ethynyl]-4-[2-(4-nitrophenyl)ethynyl]-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-N,N-dimethylaniline.
| Compound Name | 4-[3-[2-[4-(dimethylamino)phenyl]ethynyl]-4-[2-(4-nitrophenyl)ethynyl]-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 15807635 |
| Molecular Formula | C41H45N3O2Si |
| Molecular Weight | 639.92 g/mol |
| Exact Mass | 639.33 |
| IUPAC Name | 4-[3-[2-[4-(dimethylamino)phenyl]ethynyl]-4-[2-(4-nitrophenyl)ethynyl]-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-N,N-dimethylaniline |
| SMILES | CC(C)[Si](C#CC(C#Cc1ccc([N+](=O)[O-])cc1)=C(C#Cc1ccc(N(C)C)cc1)C#Cc1ccc(N(C)C)cc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C41H45N3O2Si/c1-31(2)47(32(3)4,33(5)6)30-29-38(22-13-36-18-27-41(28-19-36)44(45)46)37(20-11-34-14-23-39(24-15-34)42(7)8)21-12-35-16-25-40(26-17-35)43(9)10/h14-19,23-28,31-33H,1-10H3 |
| InChIKey | PEZAQMSIQZSJLM-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.92 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|