C36H50N4O4Si2 — CID 10963360
3-N,4-N-bis(4-nitrophenyl)-1,6-bis[tri(propan-2-yl)silyl]hexa-1,5-diyne-3,4-diimine (PubChem CID 10963360) has the molecular formula C36H50N4O4Si2 and a molecular weight of 658.99 g/mol. Its IUPAC name is 3-N,4-N-bis(4-nitrophenyl)-1,6-bis[tri(propan-2-yl)silyl]hexa-1,5-diyne-3,4-diimine.
| Compound Name | 3-N,4-N-bis(4-nitrophenyl)-1,6-bis[tri(propan-2-yl)silyl]hexa-1,5-diyne-3,4-diimine |
|---|---|
| PubChem CID | 10963360 |
| Molecular Formula | C36H50N4O4Si2 |
| Molecular Weight | 658.99 g/mol |
| Exact Mass | 658.34 |
| IUPAC Name | 3-N,4-N-bis(4-nitrophenyl)-1,6-bis[tri(propan-2-yl)silyl]hexa-1,5-diyne-3,4-diimine |
| SMILES | CC(C)[Si](C#CC(=N\c1ccc([N+](=O)[O-])cc1)/C(C#C[Si](C(C)C)(C(C)C)C(C)C)=N/c1ccc([N+](=O)[O-])cc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H50N4O4Si2/c1-25(2)45(26(3)4,27(5)6)23-21-35(37-31-13-17-33(18-14-31)39(41)42)36(38-32-15-19-34(20-16-32)40(43)44)22-24-46(28(7)8,29(9)10)30(11)12/h13-20,25-30H,1-12H3/b37-35+,38-36+ |
| InChIKey | GTAPFSDEMPURJE-ATXIYDNESA-N |
| XLogP | 10.79 |
| TPSA | 111.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.99 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|