C31H32Si — CID 14935770
[3-ethynyl-6-phenyl-4-(2-phenylethynyl)hex-3-en-1,5-diynyl]-tri(propan-2-yl)silane (PubChem CID 14935770) has the molecular formula C31H32Si and a molecular weight of 432.68 g/mol. Its IUPAC name is [3-ethynyl-6-phenyl-4-(2-phenylethynyl)hex-3-en-1,5-diynyl]-tri(propan-2-yl)silane.
| Compound Name | [3-ethynyl-6-phenyl-4-(2-phenylethynyl)hex-3-en-1,5-diynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 14935770 |
| Molecular Formula | C31H32Si |
| Molecular Weight | 432.68 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | [3-ethynyl-6-phenyl-4-(2-phenylethynyl)hex-3-en-1,5-diynyl]-tri(propan-2-yl)silane |
| SMILES | C#CC(C#C[Si](C(C)C)(C(C)C)C(C)C)=C(C#Cc1ccccc1)C#Cc1ccccc1 |
| InChI | InChI=1S/C31H32Si/c1-8-30(23-24-32(25(2)3,26(4)5)27(6)7)31(21-19-28-15-11-9-12-16-28)22-20-29-17-13-10-14-18-29/h1,9-18,25-27H,2-7H3 |
| InChIKey | DYMJDYUVFYVVMH-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.68 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|