C26H34Si — CID 102235449
3-benzhydrylbut-3-en-1-ynyl-tri(propan-2-yl)silane (PubChem CID 102235449) has the molecular formula C26H34Si and a molecular weight of 374.64 g/mol. Its IUPAC name is 3-benzhydrylbut-3-en-1-ynyl-tri(propan-2-yl)silane.
| Compound Name | 3-benzhydrylbut-3-en-1-ynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 102235449 |
| Molecular Formula | C26H34Si |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 3-benzhydrylbut-3-en-1-ynyl-tri(propan-2-yl)silane |
| SMILES | C=C(C#C[Si](C(C)C)(C(C)C)C(C)C)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H34Si/c1-20(2)27(21(3)4,22(5)6)19-18-23(7)26(24-14-10-8-11-15-24)25-16-12-9-13-17-25/h8-17,20-22,26H,7H2,1-6H3 |
| InChIKey | UFXGMAITXPKCOZ-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|