C40H52Si2 — CID 102473895
[(E)-5,6-diphenyl-10-tri(propan-2-yl)silyldec-5-en-1,3,7,9-tetraynyl]-tri(propan-2-yl)silane (PubChem CID 102473895) has the molecular formula C40H52Si2 and a molecular weight of 589.03 g/mol. Its IUPAC name is [(E)-5,6-diphenyl-10-tri(propan-2-yl)silyldec-5-en-1,3,7,9-tetraynyl]-tri(propan-2-yl)silane.
| Compound Name | [(E)-5,6-diphenyl-10-tri(propan-2-yl)silyldec-5-en-1,3,7,9-tetraynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 102473895 |
| Molecular Formula | C40H52Si2 |
| Molecular Weight | 589.03 g/mol |
| Exact Mass | 588.36 |
| IUPAC Name | [(E)-5,6-diphenyl-10-tri(propan-2-yl)silyldec-5-en-1,3,7,9-tetraynyl]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#CC#C/C(=C(/C#CC#C[Si](C(C)C)(C(C)C)C(C)C)c1ccccc1)c1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C40H52Si2/c1-31(2)41(32(3)4,33(5)6)29-21-19-27-39(37-23-15-13-16-24-37)40(38-25-17-14-18-26-38)28-20-22-30-42(34(7)8,35(9)10)36(11)12/h13-18,23-26,31-36H,1-12H3/b40-39+ |
| InChIKey | IZCLUPYQUUYJQY-XQQUEIPISA-N |
| XLogP | 11.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.03 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|