C14H14OSi — CID 15953221
1-phenyl-5-trimethylsilylpenta-2,4-diyn-1-one (PubChem CID 15953221) has the molecular formula C14H14OSi and a molecular weight of 226.35 g/mol. Its IUPAC name is 1-phenyl-5-trimethylsilylpenta-2,4-diyn-1-one.
| Compound Name | 1-phenyl-5-trimethylsilylpenta-2,4-diyn-1-one |
|---|---|
| PubChem CID | 15953221 |
| Molecular Formula | C14H14OSi |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 1-phenyl-5-trimethylsilylpenta-2,4-diyn-1-one |
| SMILES | C[Si](C)(C)C#CC#CC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H14OSi/c1-16(2,3)12-8-7-11-14(15)13-9-5-4-6-10-13/h4-6,9-10H,1-3H3 |
| InChIKey | LBBRIVYOMQEUIT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|