About 1-phenylpenta-2,4-diyn-1-one
1-phenylpenta-2,4-diyn-1-one (PubChem CID 592950) has the molecular formula C11H6O
and a molecular weight of 154.17 g/mol. Its IUPAC name is 1-phenylpenta-2,4-diyn-1-one.
Molecular Properties
| Compound Name | 1-phenylpenta-2,4-diyn-1-one |
| PubChem CID | 592950 |
| Molecular Formula | C11H6O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.04 |
| IUPAC Name | 1-phenylpenta-2,4-diyn-1-one |
| SMILES | C#CC#CC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H6O/c1-2-3-9-11(12)10-7-5-4-6-8-10/h1,4-8H |
| InChIKey | ZKQQJUBGJLUJNT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylpenta-2,4-diyn-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpenta-2,4-diyn-1-one?
The IUPAC name of 1-phenylpenta-2,4-diyn-1-one (CID 592950) is 1-phenylpenta-2,4-diyn-1-one.
What is the SMILES notation for 1-phenylpenta-2,4-diyn-1-one?
The canonical SMILES for 1-phenylpenta-2,4-diyn-1-one is C#CC#CC(=O)c1ccccc1.
What is the InChIKey of 1-phenylpenta-2,4-diyn-1-one?
The InChIKey is ZKQQJUBGJLUJNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6O/c1-2-3-9-11(12)10-7-5-4-6-8-10/h1,4-8H.
What are the key properties of 1-phenylpenta-2,4-diyn-1-one?
1-phenylpenta-2,4-diyn-1-one has a molecular weight of 154.17 g/mol, XLogP of 1.51, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpenta-2,4-diyn-1-one is sourced from PubChem (CID 592950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).