C18H24O2 — CID 71349301
4-tert-butyl-4-hydroxy-5,5-dimethyl-1-phenylhex-2-yn-1-one (PubChem CID 71349301) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 4-tert-butyl-4-hydroxy-5,5-dimethyl-1-phenylhex-2-yn-1-one.
| Compound Name | 4-tert-butyl-4-hydroxy-5,5-dimethyl-1-phenylhex-2-yn-1-one |
|---|---|
| PubChem CID | 71349301 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 4-tert-butyl-4-hydroxy-5,5-dimethyl-1-phenylhex-2-yn-1-one |
| SMILES | CC(C)(C)C(O)(C#CC(=O)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C18H24O2/c1-16(2,3)18(20,17(4,5)6)13-12-15(19)14-10-8-7-9-11-14/h7-11,20H,1-6H3 |
| InChIKey | CGRRGSXTTGKUMI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|