C19H20Si — CID 135024613
[(E)-3,4-diphenylbut-3-en-1-ynyl]-trimethylsilane (PubChem CID 135024613) has the molecular formula C19H20Si and a molecular weight of 276.46 g/mol. Its IUPAC name is [(E)-3,4-diphenylbut-3-en-1-ynyl]-trimethylsilane.
| Compound Name | [(E)-3,4-diphenylbut-3-en-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 135024613 |
| Molecular Formula | C19H20Si |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | [(E)-3,4-diphenylbut-3-en-1-ynyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C#C/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20Si/c1-20(2,3)15-14-19(18-12-8-5-9-13-18)16-17-10-6-4-7-11-17/h4-13,16H,1-3H3/b19-16- |
| InChIKey | DSKZXRGGLXJLMT-MNDPQUGUSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|