C24H26Si — CID 10854822
[(Z)-3,9-diphenylnon-3-en-1,5-diynyl]-trimethylsilane (PubChem CID 10854822) has the molecular formula C24H26Si and a molecular weight of 342.56 g/mol. Its IUPAC name is [(Z)-3,9-diphenylnon-3-en-1,5-diynyl]-trimethylsilane.
| Compound Name | [(Z)-3,9-diphenylnon-3-en-1,5-diynyl]-trimethylsilane |
|---|---|
| PubChem CID | 10854822 |
| Molecular Formula | C24H26Si |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | [(Z)-3,9-diphenylnon-3-en-1,5-diynyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C#C/C(=C\C#CCCCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26Si/c1-25(2,3)21-20-24(23-17-12-7-13-18-23)19-11-5-4-8-14-22-15-9-6-10-16-22/h6-7,9-10,12-13,15-19H,4,8,14H2,1-3H3/b24-19+ |
| InChIKey | WTSXFHFUGZXKGZ-LYBHJNIJSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|