C18H20N2O — CID 154680187
N-methyl-N-[[6-(5-phenylpent-1-ynyl)-2-pyridinyl]methyl]hydroxylamine (PubChem CID 154680187) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is N-methyl-N-[[6-(5-phenylpent-1-ynyl)-2-pyridinyl]methyl]hydroxylamine.
| Compound Name | N-methyl-N-[[6-(5-phenylpent-1-ynyl)-2-pyridinyl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 154680187 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N-methyl-N-[[6-(5-phenylpent-1-ynyl)-2-pyridinyl]methyl]hydroxylamine |
| SMILES | CN(O)Cc1cccc(C#CCCCc2ccccc2)n1 |
| InChI | InChI=1S/C18H20N2O/c1-20(21)15-18-14-8-13-17(19-18)12-7-3-6-11-16-9-4-2-5-10-16/h2,4-5,8-10,13-14,21H,3,6,11,15H2,1H3 |
| InChIKey | MZYPZXAZAGBYOS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|