C15H16N2 — CID 69399890
1,2-dimethyl-4-(4-phenylbut-1-ynyl)imidazole (PubChem CID 69399890) has the molecular formula C15H16N2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 1,2-dimethyl-4-(4-phenylbut-1-ynyl)imidazole.
| Compound Name | 1,2-dimethyl-4-(4-phenylbut-1-ynyl)imidazole |
|---|---|
| PubChem CID | 69399890 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1,2-dimethyl-4-(4-phenylbut-1-ynyl)imidazole |
| SMILES | Cc1nc(C#CCCc2ccccc2)cn1C |
| InChI | InChI=1S/C15H16N2/c1-13-16-15(12-17(13)2)11-7-6-10-14-8-4-3-5-9-14/h3-5,8-9,12H,6,10H2,1-2H3 |
| InChIKey | WNWXRJJUKBLIJJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|