C24H22 — CID 154721237
(5,6-dimethylidene-10-phenyldeca-3,7-diynyl)benzene (PubChem CID 154721237) has the molecular formula C24H22 and a molecular weight of 310.44 g/mol. Its IUPAC name is (5,6-dimethylidene-10-phenyldeca-3,7-diynyl)benzene.
| Compound Name | (5,6-dimethylidene-10-phenyldeca-3,7-diynyl)benzene |
|---|---|
| PubChem CID | 154721237 |
| Molecular Formula | C24H22 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (5,6-dimethylidene-10-phenyldeca-3,7-diynyl)benzene |
| SMILES | C=C(C#CCCc1ccccc1)C(=C)C#CCCc1ccccc1 |
| InChI | InChI=1S/C24H22/c1-21(13-9-11-19-23-15-5-3-6-16-23)22(2)14-10-12-20-24-17-7-4-8-18-24/h3-8,15-18H,1-2,11-12,19-20H2 |
| InChIKey | ZQLUBBWVVJBWFW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|