C20H26 — CID 145472806
ethane;[(5E,6Z)-5-ethylidene-7-methylnona-6,8-dien-3-ynyl]benzene (PubChem CID 145472806) has the molecular formula C20H26 and a molecular weight of 266.43 g/mol. Its IUPAC name is ethane;[(5E,6Z)-5-ethylidene-7-methylnona-6,8-dien-3-ynyl]benzene.
| Compound Name | ethane;[(5E,6Z)-5-ethylidene-7-methylnona-6,8-dien-3-ynyl]benzene |
|---|---|
| PubChem CID | 145472806 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | ethane;[(5E,6Z)-5-ethylidene-7-methylnona-6,8-dien-3-ynyl]benzene |
| SMILES | C=C/C(C)=C\C(C#CCCc1ccccc1)=C/C.CC |
| InChI | InChI=1S/C18H20.C2H6/c1-4-16(3)15-17(5-2)11-9-10-14-18-12-7-6-8-13-18;1-2/h4-8,12-13,15H,1,10,14H2,2-3H3;1-2H3/b16-15-,17-5-; |
| InChIKey | ZFZLRROUETZXDI-ZONSEYTPSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|