C21H27N — CID 145472991
(4E,5Z)-4-ethylidene-N,6-dimethyl-N-[(2R)-1-phenylpropan-2-yl]octa-5,7-dien-2-yn-1-amine (PubChem CID 145472991) has the molecular formula C21H27N and a molecular weight of 293.45 g/mol. Its IUPAC name is (4E,5Z)-4-ethylidene-N,6-dimethyl-N-[(2R)-1-phenylpropan-2-yl]octa-5,7-dien-2-yn-1-amine.
| Compound Name | (4E,5Z)-4-ethylidene-N,6-dimethyl-N-[(2R)-1-phenylpropan-2-yl]octa-5,7-dien-2-yn-1-amine |
|---|---|
| PubChem CID | 145472991 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | (4E,5Z)-4-ethylidene-N,6-dimethyl-N-[(2R)-1-phenylpropan-2-yl]octa-5,7-dien-2-yn-1-amine |
| SMILES | C=C/C(C)=C\C(C#CCN(C)[C@H](C)Cc1ccccc1)=C/C |
| InChI | InChI=1S/C21H27N/c1-6-18(3)16-20(7-2)14-11-15-22(5)19(4)17-21-12-9-8-10-13-21/h6-10,12-13,16,19H,1,15,17H2,2-5H3/b18-16-,20-7-/t19-/m1/s1 |
| InChIKey | RCODGLISMKKTIF-NECSYFCASA-N |
| XLogP | 4.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|