C26H35ClN2 — CID 159530490
bis(1,1-dideuterio-N-methyl-N-[(2R)-1-phenylpropan-2-yl]prop-2-yn-1-amine);hydrochloride (PubChem CID 159530490) has the molecular formula C26H35ClN2 and a molecular weight of 415.06 g/mol. Its IUPAC name is bis(1,1-dideuterio-N-methyl-N-[(2R)-1-phenylpropan-2-yl]prop-2-yn-1-amine);hydrochloride.
| Compound Name | bis(1,1-dideuterio-N-methyl-N-[(2R)-1-phenylpropan-2-yl]prop-2-yn-1-amine);hydrochloride |
|---|---|
| PubChem CID | 159530490 |
| Molecular Formula | C26H35ClN2 |
| Molecular Weight | 415.06 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | bis(1,1-dideuterio-N-methyl-N-[(2R)-1-phenylpropan-2-yl]prop-2-yn-1-amine);hydrochloride |
| SMILES | Cl.[2H]C([2H])(C#C)N(C)[C@H](C)Cc1ccccc1.[2H]C([2H])(C#C)N(C)[C@H](C)Cc1ccccc1 |
| InChI | InChI=1S/2C13H17N.ClH/c2*1-4-10-14(3)12(2)11-13-8-6-5-7-9-13;/h2*1,5-9,12H,10-11H2,2-3H3;1H/t2*12-;/m11./s1/i2*10D2; |
| InChIKey | AYCCDKUCIVIPJR-MFQGNZJRSA-N |
| XLogP | 4.79 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.06 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|