C26H33ClN2O — CID 162055633
N-(2-chloro-3-phenylpropyl)-1,1-dideuterio-N-methylprop-2-yn-1-amine;2-[1,1-dideuterioprop-2-ynyl(methyl)amino]-3-phenylpropan-1-ol (PubChem CID 162055633) has the molecular formula C26H33ClN2O and a molecular weight of 429.04 g/mol. Its IUPAC name is N-(2-chloro-3-phenylpropyl)-1,1-dideuterio-N-methylprop-2-yn-1-amine;2-[1,1-dideuterioprop-2-ynyl(methyl)amino]-3-phenylpropan-1-ol.
| Compound Name | N-(2-chloro-3-phenylpropyl)-1,1-dideuterio-N-methylprop-2-yn-1-amine;2-[1,1-dideuterioprop-2-ynyl(methyl)amino]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 162055633 |
| Molecular Formula | C26H33ClN2O |
| Molecular Weight | 429.04 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | N-(2-chloro-3-phenylpropyl)-1,1-dideuterio-N-methylprop-2-yn-1-amine;2-[1,1-dideuterioprop-2-ynyl(methyl)amino]-3-phenylpropan-1-ol |
| SMILES | [2H]C([2H])(C#C)N(C)C(CO)Cc1ccccc1.[2H]C([2H])(C#C)N(C)CC(Cl)Cc1ccccc1 |
| InChI | InChI=1S/C13H16ClN.C13H17NO/c1-3-9-15(2)11-13(14)10-12-7-5-4-6-8-12;1-3-9-14(2)13(11-15)10-12-7-5-4-6-8-12/h1,4-8,13H,9-11H2,2H3;1,4-8,13,15H,9-11H2,2H3/i2*9D2 |
| InChIKey | YZDGMHZRJQLSSE-NKSORAOPSA-N |
| XLogP | 3.56 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.04 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|