C14H21NO3 — CID 68898508
tert-butyl-[(2S)-1-hydroxy-3-phenylpropan-2-yl]carbamic acid (PubChem CID 68898508) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is tert-butyl-[(2S)-1-hydroxy-3-phenylpropan-2-yl]carbamic acid.
| Compound Name | tert-butyl-[(2S)-1-hydroxy-3-phenylpropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 68898508 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | tert-butyl-[(2S)-1-hydroxy-3-phenylpropan-2-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)[C@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C14H21NO3/c1-14(2,3)15(13(17)18)12(10-16)9-11-7-5-4-6-8-11/h4-8,12,16H,9-10H2,1-3H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | GFGILQQQJPGMRG-LBPRGKRZSA-N |
| XLogP | 2.37 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |