tert-butyl-[(2S,3R)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid

C15H23NO3 — CID 66716676

IUPACtert-butyl-[(2S,3R)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid
SMILESC[C@@H](O)[C@H](Cc1ccccc1)N(C(=O)O)C(C)(C)C
InChIInChI=1S/C15H23NO3/c1-11(17)13(10-12-8-6-5-7-9-12)16(14(18)19)15(2,3)4/h5-9,11,13,17H,10H2,1-4H3,(H,18,19)/t11-,13+/m1/s1
InChIKeyTULMLYSHRNRPQR-YPMHNXCESA-N
MW265.35 g/mol
LogP2.76
Rot. Bonds4

About tert-butyl-[(2S,3R)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid

tert-butyl-[(2S,3R)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid (PubChem CID 66716676) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is tert-butyl-[(2S,3R)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid.

Molecular Properties

Compound Nametert-butyl-[(2S,3R)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid
PubChem CID66716676
Molecular FormulaC15H23NO3
Molecular Weight265.35 g/mol
Exact Mass265.17
IUPAC Nametert-butyl-[(2S,3R)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid
SMILESC[C@@H](O)[C@H](Cc1ccccc1)N(C(=O)O)C(C)(C)C
InChIInChI=1S/C15H23NO3/c1-11(17)13(10-12-8-6-5-7-9-12)16(14(18)19)15(2,3)4/h5-9,11,13,17H,10H2,1-4H3,(H,18,19)/t11-,13+/m1/s1
InChIKeyTULMLYSHRNRPQR-YPMHNXCESA-N
XLogP2.76
TPSA60.77 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.35
LogP ≤ 52.76
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze tert-butyl-[(2S,3R)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl-[(2S,3R)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid?
The IUPAC name of tert-butyl-[(2S,3R)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid (CID 66716676) is tert-butyl-[(2S,3R)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid.
What is the SMILES notation for tert-butyl-[(2S,3R)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid?
The canonical SMILES for tert-butyl-[(2S,3R)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid is C[C@@H](O)[C@H](Cc1ccccc1)N(C(=O)O)C(C)(C)C.
What is the InChIKey of tert-butyl-[(2S,3R)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid?
The InChIKey is TULMLYSHRNRPQR-YPMHNXCESA-N. The full InChI is InChI=1S/C15H23NO3/c1-11(17)13(10-12-8-6-5-7-9-12)16(14(18)19)15(2,3)4/h5-9,11,13,17H,10H2,1-4H3,(H,18,19)/t11-,13+/m1/s1.
What are the key properties of tert-butyl-[(2S,3R)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid?
tert-butyl-[(2S,3R)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid has a molecular weight of 265.35 g/mol, XLogP of 2.76, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(2S,3R)-3-hydroxy-1-phenylbutan-2-yl]carbamic acid is sourced from PubChem (CID 66716676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).