C19H32N2O4 — CID 91123119
tert-butyl-[3-hydroxy-4-[(2-methylpropan-2-yl)oxyamino]-1-phenylbutan-2-yl]carbamic acid (PubChem CID 91123119) has the molecular formula C19H32N2O4 and a molecular weight of 352.48 g/mol. Its IUPAC name is tert-butyl-[3-hydroxy-4-[(2-methylpropan-2-yl)oxyamino]-1-phenylbutan-2-yl]carbamic acid.
| Compound Name | tert-butyl-[3-hydroxy-4-[(2-methylpropan-2-yl)oxyamino]-1-phenylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 91123119 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | tert-butyl-[3-hydroxy-4-[(2-methylpropan-2-yl)oxyamino]-1-phenylbutan-2-yl]carbamic acid |
| SMILES | CC(C)(C)ONCC(O)C(Cc1ccccc1)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C19H32N2O4/c1-18(2,3)21(17(23)24)15(12-14-10-8-7-9-11-14)16(22)13-20-25-19(4,5)6/h7-11,15-16,20,22H,12-13H2,1-6H3,(H,23,24) |
| InChIKey | RORVPEOUYOCSBT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|