About tert-butyl-[(2S,3R)-3-hydroxy-1-phenyl-4-[[(1S)-1-phenylethyl]amino]butan-2-yl]carbamic acid
tert-butyl-[(2S,3R)-3-hydroxy-1-phenyl-4-[[(1S)-1-phenylethyl]amino]butan-2-yl]carbamic acid (PubChem CID 91256407) has the molecular formula C23H32N2O3
and a molecular weight of 384.52 g/mol. Its IUPAC name is tert-butyl-[(2S,3R)-3-hydroxy-1-phenyl-4-[[(1S)-1-phenylethyl]amino]butan-2-yl]carbamic acid.
Molecular Properties
| Compound Name | tert-butyl-[(2S,3R)-3-hydroxy-1-phenyl-4-[[(1S)-1-phenylethyl]amino]butan-2-yl]carbamic acid |
| PubChem CID | 91256407 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | tert-butyl-[(2S,3R)-3-hydroxy-1-phenyl-4-[[(1S)-1-phenylethyl]amino]butan-2-yl]carbamic acid |
| SMILES | C[C@H](NC[C@@H](O)[C@H](Cc1ccccc1)N(C(=O)O)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H32N2O3/c1-17(19-13-9-6-10-14-19)24-16-21(26)20(15-18-11-7-5-8-12-18)25(22(27)28)23(2,3)4/h5-14,17,20-21,24,26H,15-16H2,1-4H3,(H,27,28)/t17-,20-,21+/m0/s1 |
| InChIKey | MLOJRUMMALDNJA-DZFGPLHGSA-N |
| XLogP | 4.09 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl-[(2S,3R)-3-hydroxy-1-phenyl-4-[[(1S)-1-phenylethyl]amino]butan-2-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(2S,3R)-3-hydroxy-1-phenyl-4-[[(1S)-1-phenylethyl]amino]butan-2-yl]carbamic acid?
The IUPAC name of tert-butyl-[(2S,3R)-3-hydroxy-1-phenyl-4-[[(1S)-1-phenylethyl]amino]butan-2-yl]carbamic acid (CID 91256407) is tert-butyl-[(2S,3R)-3-hydroxy-1-phenyl-4-[[(1S)-1-phenylethyl]amino]butan-2-yl]carbamic acid.
What is the SMILES notation for tert-butyl-[(2S,3R)-3-hydroxy-1-phenyl-4-[[(1S)-1-phenylethyl]amino]butan-2-yl]carbamic acid?
The canonical SMILES for tert-butyl-[(2S,3R)-3-hydroxy-1-phenyl-4-[[(1S)-1-phenylethyl]amino]butan-2-yl]carbamic acid is C[C@H](NC[C@@H](O)[C@H](Cc1ccccc1)N(C(=O)O)C(C)(C)C)c1ccccc1.
What is the InChIKey of tert-butyl-[(2S,3R)-3-hydroxy-1-phenyl-4-[[(1S)-1-phenylethyl]amino]butan-2-yl]carbamic acid?
The InChIKey is MLOJRUMMALDNJA-DZFGPLHGSA-N. The full InChI is InChI=1S/C23H32N2O3/c1-17(19-13-9-6-10-14-19)24-16-21(26)20(15-18-11-7-5-8-12-18)25(22(27)28)23(2,3)4/h5-14,17,20-21,24,26H,15-16H2,1-4H3,(H,27,28)/t17-,20-,21+/m0/s1.
What are the key properties of tert-butyl-[(2S,3R)-3-hydroxy-1-phenyl-4-[[(1S)-1-phenylethyl]amino]butan-2-yl]carbamic acid?
tert-butyl-[(2S,3R)-3-hydroxy-1-phenyl-4-[[(1S)-1-phenylethyl]amino]butan-2-yl]carbamic acid has a molecular weight of 384.52 g/mol, XLogP of 4.09, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(2S,3R)-3-hydroxy-1-phenyl-4-[[(1S)-1-phenylethyl]amino]butan-2-yl]carbamic acid is sourced from PubChem (CID 91256407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).