C14H21NO2 — CID 66990689
tert-butyl-[(2R)-1-phenylpropan-2-yl]carbamic acid (PubChem CID 66990689) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is tert-butyl-[(2R)-1-phenylpropan-2-yl]carbamic acid.
| Compound Name | tert-butyl-[(2R)-1-phenylpropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 66990689 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | tert-butyl-[(2R)-1-phenylpropan-2-yl]carbamic acid |
| SMILES | C[C@H](Cc1ccccc1)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C14H21NO2/c1-11(10-12-8-6-5-7-9-12)15(13(16)17)14(2,3)4/h5-9,11H,10H2,1-4H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | CXXFYUREEOVOKO-LLVKDONJSA-N |
| XLogP | 3.40 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |