C19H30N2O3 — CID 68573466
tert-butyl-[(2R)-1-(3-methylbutylamino)-1-oxo-3-phenylpropan-2-yl]carbamic acid (PubChem CID 68573466) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is tert-butyl-[(2R)-1-(3-methylbutylamino)-1-oxo-3-phenylpropan-2-yl]carbamic acid.
| Compound Name | tert-butyl-[(2R)-1-(3-methylbutylamino)-1-oxo-3-phenylpropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 68573466 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | tert-butyl-[(2R)-1-(3-methylbutylamino)-1-oxo-3-phenylpropan-2-yl]carbamic acid |
| SMILES | CC(C)CCNC(=O)[C@@H](Cc1ccccc1)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C19H30N2O3/c1-14(2)11-12-20-17(22)16(13-15-9-7-6-8-10-15)21(18(23)24)19(3,4)5/h6-10,14,16H,11-13H2,1-5H3,(H,20,22)(H,23,24)/t16-/m1/s1 |
| InChIKey | CVPFIOIGUOADFT-MRXNPFEDSA-N |
| XLogP | 3.54 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |