C12H20IN — CID 23619188
N,N-dimethyl-1-phenylpropan-2-amine;iodomethane (PubChem CID 23619188) has the molecular formula C12H20IN and a molecular weight of 305.20 g/mol. Its IUPAC name is N,N-dimethyl-1-phenylpropan-2-amine;iodomethane.
| Compound Name | N,N-dimethyl-1-phenylpropan-2-amine;iodomethane |
|---|---|
| PubChem CID | 23619188 |
| Molecular Formula | C12H20IN |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | N,N-dimethyl-1-phenylpropan-2-amine;iodomethane |
| SMILES | CC(Cc1ccccc1)N(C)C.CI |
| InChI | InChI=1S/C11H17N.CH3I/c1-10(12(2)3)9-11-7-5-4-6-8-11;1-2/h4-8,10H,9H2,1-3H3;1H3 |
| InChIKey | HIXFBNBPORYGIR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|