C11H16IN — CID 90144903
(2R)-1-(3-iodophenyl)-N,N-dimethylpropan-2-amine (PubChem CID 90144903) has the molecular formula C11H16IN and a molecular weight of 289.16 g/mol. Its IUPAC name is (2R)-1-(3-iodophenyl)-N,N-dimethylpropan-2-amine.
| Compound Name | (2R)-1-(3-iodophenyl)-N,N-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 90144903 |
| Molecular Formula | C11H16IN |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | (2R)-1-(3-iodophenyl)-N,N-dimethylpropan-2-amine |
| SMILES | C[C@H](Cc1cccc(I)c1)N(C)C |
| InChI | InChI=1S/C11H16IN/c1-9(13(2)3)7-10-5-4-6-11(12)8-10/h4-6,8-9H,7H2,1-3H3/t9-/m1/s1 |
| InChIKey | PLEQNNTWJKZECI-SECBINFHSA-N |
| XLogP | 2.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|