C17H21N — CID 144654659
(2E,4Z)-N-benzyl-3-ethenyl-5-methylhepta-2,4,6-trien-2-amine (PubChem CID 144654659) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is (2E,4Z)-N-benzyl-3-ethenyl-5-methylhepta-2,4,6-trien-2-amine.
| Compound Name | (2E,4Z)-N-benzyl-3-ethenyl-5-methylhepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 144654659 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | (2E,4Z)-N-benzyl-3-ethenyl-5-methylhepta-2,4,6-trien-2-amine |
| SMILES | C=C/C(C)=C\C(C=C)=C(/C)NCc1ccccc1 |
| InChI | InChI=1S/C17H21N/c1-5-14(3)12-17(6-2)15(4)18-13-16-10-8-7-9-11-16/h5-12,18H,1-2,13H2,3-4H3/b14-12-,17-15+ |
| InChIKey | FXDAUNDUXHJZSG-KPANNZBFSA-N |
| XLogP | 4.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|