C17H23NO4 — CID 162685353
2-(benzylamino)acetic acid;formic acid;(3Z)-3-methylhexa-1,3,5-triene (PubChem CID 162685353) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 2-(benzylamino)acetic acid;formic acid;(3Z)-3-methylhexa-1,3,5-triene.
| Compound Name | 2-(benzylamino)acetic acid;formic acid;(3Z)-3-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 162685353 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-(benzylamino)acetic acid;formic acid;(3Z)-3-methylhexa-1,3,5-triene |
| SMILES | C=C/C=C(/C)C=C.O=C(O)CNCc1ccccc1.O=CO |
| InChI | InChI=1S/C9H11NO2.C7H10.CH2O2/c11-9(12)7-10-6-8-4-2-1-3-5-8;1-4-6-7(3)5-2;2-1-3/h1-5,10H,6-7H2,(H,11,12);4-6H,1-2H2,3H3;1H,(H,2,3)/b;7-6-; |
| InChIKey | XFDRRHMMKSOQGB-IICHUWEQSA-N |
| XLogP | 2.87 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|