C23H34N2O5 — CID 162685389
benzyl N-(3-methylbutan-2-yl)carbamate;2-formamidoacetic acid;(3Z)-3-methylhexa-1,3,5-triene (PubChem CID 162685389) has the molecular formula C23H34N2O5 and a molecular weight of 418.53 g/mol. Its IUPAC name is benzyl N-(3-methylbutan-2-yl)carbamate;2-formamidoacetic acid;(3Z)-3-methylhexa-1,3,5-triene.
| Compound Name | benzyl N-(3-methylbutan-2-yl)carbamate;2-formamidoacetic acid;(3Z)-3-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 162685389 |
| Molecular Formula | C23H34N2O5 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | benzyl N-(3-methylbutan-2-yl)carbamate;2-formamidoacetic acid;(3Z)-3-methylhexa-1,3,5-triene |
| SMILES | C=C/C=C(/C)C=C.CC(C)C(C)NC(=O)OCc1ccccc1.O=CNCC(=O)O |
| InChI | InChI=1S/C13H19NO2.C7H10.C3H5NO3/c1-10(2)11(3)14-13(15)16-9-12-7-5-4-6-8-12;1-4-6-7(3)5-2;5-2-4-1-3(6)7/h4-8,10-11H,9H2,1-3H3,(H,14,15);4-6H,1-2H2,3H3;2H,1H2,(H,4,5)(H,6,7)/b;7-6-; |
| InChIKey | SPXWBGHLLDFECN-IICHUWEQSA-N |
| XLogP | 4.08 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|