C19H29N3 — CID 88931064
N'-benzyl-N-[2-[[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]amino]ethyl]ethane-1,2-diamine (PubChem CID 88931064) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is N'-benzyl-N-[2-[[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]amino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-benzyl-N-[2-[[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]amino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 88931064 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | N'-benzyl-N-[2-[[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]amino]ethyl]ethane-1,2-diamine |
| SMILES | C=C/C=C(\C=C/C)CNCCNCCNCc1ccccc1 |
| InChI | InChI=1S/C19H29N3/c1-3-8-18(9-4-2)16-21-14-12-20-13-15-22-17-19-10-6-5-7-11-19/h3-11,20-22H,1,12-17H2,2H3/b9-4-,18-8+ |
| InChIKey | LMXSXPFQUGZLRF-ZFHQFQHJSA-N |
| XLogP | 2.64 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|