C13H21NO3 — CID 163373715
2-[(4-hydroxyphenyl)methylamino]acetic acid;2-methylpropane (PubChem CID 163373715) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 2-[(4-hydroxyphenyl)methylamino]acetic acid;2-methylpropane.
| Compound Name | 2-[(4-hydroxyphenyl)methylamino]acetic acid;2-methylpropane |
|---|---|
| PubChem CID | 163373715 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2-[(4-hydroxyphenyl)methylamino]acetic acid;2-methylpropane |
| SMILES | CC(C)C.O=C(O)CNCc1ccc(O)cc1 |
| InChI | InChI=1S/C9H11NO3.C4H10/c11-8-3-1-7(2-4-8)5-10-6-9(12)13;1-4(2)3/h1-4,10-11H,5-6H2,(H,12,13);4H,1-3H3 |
| InChIKey | UUCURQYHFPIOSZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |