C16H22O — CID 15880988
(4R)-2,2-dimethyl-8-phenyloct-5-yn-4-ol (PubChem CID 15880988) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is (4R)-2,2-dimethyl-8-phenyloct-5-yn-4-ol.
| Compound Name | (4R)-2,2-dimethyl-8-phenyloct-5-yn-4-ol |
|---|---|
| PubChem CID | 15880988 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (4R)-2,2-dimethyl-8-phenyloct-5-yn-4-ol |
| SMILES | CC(C)(C)C[C@@H](O)C#CCCc1ccccc1 |
| InChI | InChI=1S/C16H22O/c1-16(2,3)13-15(17)12-8-7-11-14-9-5-4-6-10-14/h4-6,9-10,15,17H,7,11,13H2,1-3H3/t15-/m0/s1 |
| InChIKey | NFISIVCYFGPQFN-HNNXBMFYSA-N |
| XLogP | 3.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|