C14H18O2 — CID 101480426
8-phenyloct-4-yne-1,6-diol (PubChem CID 101480426) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 8-phenyloct-4-yne-1,6-diol.
| Compound Name | 8-phenyloct-4-yne-1,6-diol |
|---|---|
| PubChem CID | 101480426 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 8-phenyloct-4-yne-1,6-diol |
| SMILES | OCCCC#CC(O)CCc1ccccc1 |
| InChI | InChI=1S/C14H18O2/c15-12-6-2-5-9-14(16)11-10-13-7-3-1-4-8-13/h1,3-4,7-8,14-16H,2,6,10-12H2 |
| InChIKey | VOPTWYJVIFJNMQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|