About (3S)-1,5-diphenylpent-1-yn-3-ol
(3S)-1,5-diphenylpent-1-yn-3-ol (PubChem CID 54756336) has the molecular formula C17H16O
and a molecular weight of 236.31 g/mol. Its IUPAC name is (3S)-1,5-diphenylpent-1-yn-3-ol.
Molecular Properties
| Compound Name | (3S)-1,5-diphenylpent-1-yn-3-ol |
| PubChem CID | 54756336 |
| Molecular Formula | C17H16O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (3S)-1,5-diphenylpent-1-yn-3-ol |
| SMILES | O[C@H](C#Cc1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C17H16O/c18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16/h1-10,17-18H,11,13H2/t17-/m0/s1 |
| InChIKey | OBVRSXITECTJTM-KRWDZBQOSA-N |
| XLogP | 3.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1,5-diphenylpent-1-yn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1,5-diphenylpent-1-yn-3-ol?
The IUPAC name of (3S)-1,5-diphenylpent-1-yn-3-ol (CID 54756336) is (3S)-1,5-diphenylpent-1-yn-3-ol.
What is the SMILES notation for (3S)-1,5-diphenylpent-1-yn-3-ol?
The canonical SMILES for (3S)-1,5-diphenylpent-1-yn-3-ol is O[C@H](C#Cc1ccccc1)CCc1ccccc1.
What is the InChIKey of (3S)-1,5-diphenylpent-1-yn-3-ol?
The InChIKey is OBVRSXITECTJTM-KRWDZBQOSA-N. The full InChI is InChI=1S/C17H16O/c18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16/h1-10,17-18H,11,13H2/t17-/m0/s1.
What are the key properties of (3S)-1,5-diphenylpent-1-yn-3-ol?
(3S)-1,5-diphenylpent-1-yn-3-ol has a molecular weight of 236.31 g/mol, XLogP of 3.03, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1,5-diphenylpent-1-yn-3-ol is sourced from PubChem (CID 54756336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).