C21H23N — CID 142730750
1-(1,5-diphenylpent-1-yn-3-yl)pyrrolidine (PubChem CID 142730750) has the molecular formula C21H23N and a molecular weight of 289.42 g/mol. Its IUPAC name is 1-(1,5-diphenylpent-1-yn-3-yl)pyrrolidine.
| Compound Name | 1-(1,5-diphenylpent-1-yn-3-yl)pyrrolidine |
|---|---|
| PubChem CID | 142730750 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1-(1,5-diphenylpent-1-yn-3-yl)pyrrolidine |
| SMILES | C(#CC(CCc1ccccc1)N1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C21H23N/c1-3-9-19(10-4-1)13-15-21(22-17-7-8-18-22)16-14-20-11-5-2-6-12-20/h1-6,9-12,21H,7-8,13,15,17-18H2 |
| InChIKey | IOOIERDJDDQTCZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|