C20H21N — CID 100954727
1-(1,4-diphenylbut-3-yn-2-yl)pyrrolidine (PubChem CID 100954727) has the molecular formula C20H21N and a molecular weight of 275.40 g/mol. Its IUPAC name is 1-(1,4-diphenylbut-3-yn-2-yl)pyrrolidine.
| Compound Name | 1-(1,4-diphenylbut-3-yn-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 100954727 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 1-(1,4-diphenylbut-3-yn-2-yl)pyrrolidine |
| SMILES | C(#CC(Cc1ccccc1)N1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C20H21N/c1-3-9-18(10-4-1)13-14-20(21-15-7-8-16-21)17-19-11-5-2-6-12-19/h1-6,9-12,20H,7-8,15-17H2 |
| InChIKey | QEQNONJFRAQKDD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|