C19H27N — CID 101406137
1-(4-methyl-1-phenylhept-1-yn-3-yl)piperidine (PubChem CID 101406137) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is 1-(4-methyl-1-phenylhept-1-yn-3-yl)piperidine.
| Compound Name | 1-(4-methyl-1-phenylhept-1-yn-3-yl)piperidine |
|---|---|
| PubChem CID | 101406137 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 1-(4-methyl-1-phenylhept-1-yn-3-yl)piperidine |
| SMILES | CCCC(C)C(C#Cc1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C19H27N/c1-3-10-17(2)19(20-15-8-5-9-16-20)14-13-18-11-6-4-7-12-18/h4,6-7,11-12,17,19H,3,5,8-10,15-16H2,1-2H3 |
| InChIKey | LVCYZJBTHVNTAM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|