C26H36N2O2 — CID 142207135
(3R,4R)-1,6-diphenyl-2,5-dipyrrolidin-1-ylhexane-3,4-diol (PubChem CID 142207135) has the molecular formula C26H36N2O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is (3R,4R)-1,6-diphenyl-2,5-dipyrrolidin-1-ylhexane-3,4-diol.
| Compound Name | (3R,4R)-1,6-diphenyl-2,5-dipyrrolidin-1-ylhexane-3,4-diol |
|---|---|
| PubChem CID | 142207135 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | (3R,4R)-1,6-diphenyl-2,5-dipyrrolidin-1-ylhexane-3,4-diol |
| SMILES | O[C@H](C(Cc1ccccc1)N1CCCC1)[C@H](O)C(Cc1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C26H36N2O2/c29-25(23(27-15-7-8-16-27)19-21-11-3-1-4-12-21)26(30)24(28-17-9-10-18-28)20-22-13-5-2-6-14-22/h1-6,11-14,23-26,29-30H,7-10,15-20H2/t23?,24?,25-,26-/m1/s1 |
| InChIKey | PGQWUYVGIKJAMT-CVQXOBEKSA-N |
| XLogP | 3.12 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |