C39H50N2S2 — CID 161192461
(1R,2S)-1,3-diphenyl-2-piperidin-1-ylpropane-1-thiol;(1R,2S)-1,2-diphenyl-2-pyrrolidin-1-ylethanethiol;methane (PubChem CID 161192461) has the molecular formula C39H50N2S2 and a molecular weight of 610.98 g/mol. Its IUPAC name is (1R,2S)-1,3-diphenyl-2-piperidin-1-ylpropane-1-thiol;(1R,2S)-1,2-diphenyl-2-pyrrolidin-1-ylethanethiol;methane.
| Compound Name | (1R,2S)-1,3-diphenyl-2-piperidin-1-ylpropane-1-thiol;(1R,2S)-1,2-diphenyl-2-pyrrolidin-1-ylethanethiol;methane |
|---|---|
| PubChem CID | 161192461 |
| Molecular Formula | C39H50N2S2 |
| Molecular Weight | 610.98 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | (1R,2S)-1,3-diphenyl-2-piperidin-1-ylpropane-1-thiol;(1R,2S)-1,2-diphenyl-2-pyrrolidin-1-ylethanethiol;methane |
| SMILES | C.S[C@H](c1ccccc1)[C@H](Cc1ccccc1)N1CCCCC1.S[C@H](c1ccccc1)[C@H](c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C20H25NS.C18H21NS.CH4/c22-20(18-12-6-2-7-13-18)19(21-14-8-3-9-15-21)16-17-10-4-1-5-11-17;20-18(16-11-5-2-6-12-16)17(19-13-7-8-14-19)15-9-3-1-4-10-15;/h1-2,4-7,10-13,19-20,22H,3,8-9,14-16H2;1-6,9-12,17-18,20H,7-8,13-14H2;1H4/t19-,20+;17-,18+;/m00./s1 |
| InChIKey | UTXDHCZGOQROIA-PKSQETOLSA-N |
| XLogP | 9.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.98 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|