C52H58N2O2P2 — CID 101080221
[(2R,3S,4S,5R)-4-diphenylphosphanyloxy-1,6-diphenyl-2,5-di(piperidin-1-yl)hexan-3-yl]oxy-diphenylphosphane (PubChem CID 101080221) has the molecular formula C52H58N2O2P2 and a molecular weight of 805.00 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-4-diphenylphosphanyloxy-1,6-diphenyl-2,5-di(piperidin-1-yl)hexan-3-yl]oxy-diphenylphosphane.
| Compound Name | [(2R,3S,4S,5R)-4-diphenylphosphanyloxy-1,6-diphenyl-2,5-di(piperidin-1-yl)hexan-3-yl]oxy-diphenylphosphane |
|---|---|
| PubChem CID | 101080221 |
| Molecular Formula | C52H58N2O2P2 |
| Molecular Weight | 805.00 g/mol |
| Exact Mass | 804.40 |
| IUPAC Name | [(2R,3S,4S,5R)-4-diphenylphosphanyloxy-1,6-diphenyl-2,5-di(piperidin-1-yl)hexan-3-yl]oxy-diphenylphosphane |
| SMILES | c1ccc(C[C@H]([C@H](OP(c2ccccc2)c2ccccc2)[C@@H](OP(c2ccccc2)c2ccccc2)[C@@H](Cc2ccccc2)N2CCCCC2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C52H58N2O2P2/c1-9-25-43(26-10-1)41-49(53-37-21-7-22-38-53)51(55-57(45-29-13-3-14-30-45)46-31-15-4-16-32-46)52(50(54-39-23-8-24-40-54)42-44-27-11-2-12-28-44)56-58(47-33-17-5-18-34-47)48-35-19-6-20-36-48/h1-6,9-20,25-36,49-52H,7-8,21-24,37-42H2/t49-,50-,51+,52+/m1/s1 |
| InChIKey | LZAZXKPBILCCHL-DSIMHHNMSA-N |
| XLogP | 10.05 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.00 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|