C12H12Cl2 — CID 164665221
6,6-dichlorohex-4-ynylbenzene (PubChem CID 164665221) has the molecular formula C12H12Cl2 and a molecular weight of 227.13 g/mol. Its IUPAC name is 6,6-dichlorohex-4-ynylbenzene.
| Compound Name | 6,6-dichlorohex-4-ynylbenzene |
|---|---|
| PubChem CID | 164665221 |
| Molecular Formula | C12H12Cl2 |
| Molecular Weight | 227.13 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 6,6-dichlorohex-4-ynylbenzene |
| SMILES | ClC(Cl)C#CCCCc1ccccc1 |
| InChI | InChI=1S/C12H12Cl2/c13-12(14)10-6-2-5-9-11-7-3-1-4-8-11/h1,3-4,7-8,12H,2,5,9H2 |
| InChIKey | BSMOEJXJCWLPRV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.13 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|